C21H28FNO — CID 156649494
fluoromethane;3-methyl-2-[3-(4-methylphenoxy)propyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 156649494) has the molecular formula C21H28FNO and a molecular weight of 329.46 g/mol. Its IUPAC name is fluoromethane;3-methyl-2-[3-(4-methylphenoxy)propyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | fluoromethane;3-methyl-2-[3-(4-methylphenoxy)propyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 156649494 |
| Molecular Formula | C21H28FNO |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | fluoromethane;3-methyl-2-[3-(4-methylphenoxy)propyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | CF.Cc1ccc(OCCCN2Cc3ccccc3CC2C)cc1 |
| InChI | InChI=1S/C20H25NO.CH3F/c1-16-8-10-20(11-9-16)22-13-5-12-21-15-19-7-4-3-6-18(19)14-17(21)2;1-2/h3-4,6-11,17H,5,12-15H2,1-2H3;1H3 |
| InChIKey | SGRVTECRSZSLGT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|