2-acetamidohex-5-enoic acid

C8H13NO3 — CID 15664955

IUPAC2-acetamidohex-5-enoic acid
SMILESC=CCCC(NC(C)=O)C(=O)O
InChIInChI=1S/C8H13NO3/c1-3-4-5-7(8(11)12)9-6(2)10/h3,7H,1,4-5H2,2H3,(H,9,10)(H,11,12)
InChIKeyFYWHOYJRXYDLDV-UHFFFAOYSA-N
MW171.20 g/mol
LogP0.54
Rot. Bonds5

About 2-acetamidohex-5-enoic acid

2-acetamidohex-5-enoic acid (PubChem CID 15664955) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-acetamidohex-5-enoic acid.

Molecular Properties

Compound Name2-acetamidohex-5-enoic acid
PubChem CID15664955
Molecular FormulaC8H13NO3
Molecular Weight171.20 g/mol
Exact Mass171.09
IUPAC Name2-acetamidohex-5-enoic acid
SMILESC=CCCC(NC(C)=O)C(=O)O
InChIInChI=1S/C8H13NO3/c1-3-4-5-7(8(11)12)9-6(2)10/h3,7H,1,4-5H2,2H3,(H,9,10)(H,11,12)
InChIKeyFYWHOYJRXYDLDV-UHFFFAOYSA-N
XLogP0.54
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.20
LogP ≤ 50.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-acetamidohex-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamidohex-5-enoic acid?
The IUPAC name of 2-acetamidohex-5-enoic acid (CID 15664955) is 2-acetamidohex-5-enoic acid.
What is the SMILES notation for 2-acetamidohex-5-enoic acid?
The canonical SMILES for 2-acetamidohex-5-enoic acid is C=CCCC(NC(C)=O)C(=O)O.
What is the InChIKey of 2-acetamidohex-5-enoic acid?
The InChIKey is FYWHOYJRXYDLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-3-4-5-7(8(11)12)9-6(2)10/h3,7H,1,4-5H2,2H3,(H,9,10)(H,11,12).
What are the key properties of 2-acetamidohex-5-enoic acid?
2-acetamidohex-5-enoic acid has a molecular weight of 171.20 g/mol, XLogP of 0.54, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidohex-5-enoic acid is sourced from PubChem (CID 15664955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).