About 2-acetamidohex-5-enoic acid
2-acetamidohex-5-enoic acid (PubChem CID 15664955) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-acetamidohex-5-enoic acid.
Molecular Properties
| Compound Name | 2-acetamidohex-5-enoic acid |
| PubChem CID | 15664955 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2-acetamidohex-5-enoic acid |
| SMILES | C=CCCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H13NO3/c1-3-4-5-7(8(11)12)9-6(2)10/h3,7H,1,4-5H2,2H3,(H,9,10)(H,11,12) |
| InChIKey | FYWHOYJRXYDLDV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidohex-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidohex-5-enoic acid?
The IUPAC name of 2-acetamidohex-5-enoic acid (CID 15664955) is 2-acetamidohex-5-enoic acid.
What is the SMILES notation for 2-acetamidohex-5-enoic acid?
The canonical SMILES for 2-acetamidohex-5-enoic acid is C=CCCC(NC(C)=O)C(=O)O.
What is the InChIKey of 2-acetamidohex-5-enoic acid?
The InChIKey is FYWHOYJRXYDLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-3-4-5-7(8(11)12)9-6(2)10/h3,7H,1,4-5H2,2H3,(H,9,10)(H,11,12).
What are the key properties of 2-acetamidohex-5-enoic acid?
2-acetamidohex-5-enoic acid has a molecular weight of 171.20 g/mol, XLogP of 0.54, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidohex-5-enoic acid is sourced from PubChem (CID 15664955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).