About CID 156649576
CID 156649576 (PubChem CID 156649576) has the molecular formula C17H14AlFN2O
and a molecular weight of 308.29 g/mol.
Molecular Properties
| Compound Name | CID 156649576 |
| PubChem CID | 156649576 |
| Molecular Formula | C17H14AlFN2O |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | — |
| SMILES | CN(Cc1ccc(F)cc1[Al])C(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H14FN2O.Al/c1-20(11-12-6-8-14(18)9-7-12)17(21)16-10-13-4-2-3-5-15(13)19-16;/h2-6,8-10,19H,11H2,1H3; |
| InChIKey | BRELXZICGDCSRC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 156649576 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156649576?
The IUPAC name of CID 156649576 (CID 156649576) is not available.
What is the SMILES notation for CID 156649576?
The canonical SMILES for CID 156649576 is CN(Cc1ccc(F)cc1[Al])C(=O)c1cc2ccccc2[nH]1.
What is the InChIKey of CID 156649576?
The InChIKey is BRELXZICGDCSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN2O.Al/c1-20(11-12-6-8-14(18)9-7-12)17(21)16-10-13-4-2-3-5-15(13)19-16;/h2-6,8-10,19H,11H2,1H3;.
What are the key properties of CID 156649576?
CID 156649576 has a molecular weight of 308.29 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156649576 is sourced from PubChem (CID 156649576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).