About N,N-dimethylmethanimidamide;N-methylhydroxylamine
N,N-dimethylmethanimidamide;N-methylhydroxylamine (PubChem CID 156650202) has the molecular formula C4H13N3O
and a molecular weight of 119.17 g/mol. Its IUPAC name is N,N-dimethylmethanimidamide;N-methylhydroxylamine.
Molecular Properties
| Compound Name | N,N-dimethylmethanimidamide;N-methylhydroxylamine |
| PubChem CID | 156650202 |
| Molecular Formula | C4H13N3O |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.11 |
| IUPAC Name | N,N-dimethylmethanimidamide;N-methylhydroxylamine |
| SMILES | CNO.[H]/N=C/N(C)C |
| InChI | InChI=1S/C3H8N2.CH5NO/c1-5(2)3-4;1-2-3/h3-4H,1-2H3;2-3H,1H3/b4-3+; |
| InChIKey | WILYEIQEQULWLR-BJILWQEISA-N |
| XLogP | -0.25 |
| TPSA | 59.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanimidamide;N-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanimidamide;N-methylhydroxylamine?
The IUPAC name of N,N-dimethylmethanimidamide;N-methylhydroxylamine (CID 156650202) is N,N-dimethylmethanimidamide;N-methylhydroxylamine.
What is the SMILES notation for N,N-dimethylmethanimidamide;N-methylhydroxylamine?
The canonical SMILES for N,N-dimethylmethanimidamide;N-methylhydroxylamine is CNO.[H]/N=C/N(C)C.
What is the InChIKey of N,N-dimethylmethanimidamide;N-methylhydroxylamine?
The InChIKey is WILYEIQEQULWLR-BJILWQEISA-N. The full InChI is InChI=1S/C3H8N2.CH5NO/c1-5(2)3-4;1-2-3/h3-4H,1-2H3;2-3H,1H3/b4-3+;.
What are the key properties of N,N-dimethylmethanimidamide;N-methylhydroxylamine?
N,N-dimethylmethanimidamide;N-methylhydroxylamine has a molecular weight of 119.17 g/mol, XLogP of -0.25, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanimidamide;N-methylhydroxylamine is sourced from PubChem (CID 156650202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).