About [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate
[(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate (PubChem CID 156650219) has the molecular formula C15H15F3N2OS
and a molecular weight of 328.36 g/mol. Its IUPAC name is [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate.
Molecular Properties
| Compound Name | [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate |
| PubChem CID | 156650219 |
| Molecular Formula | C15H15F3N2OS |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate |
| SMILES | C=CN(C)/C(=N\C)S/C=C/C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2OS/c1-4-20(3)14(19-2)22-9-8-13(21)11-6-5-7-12(10-11)15(16,17)18/h4-10H,1H2,2-3H3/b9-8+,19-14+ |
| InChIKey | QQBLFGRUEGMVNW-ZMYBKAFPSA-N |
| XLogP | 4.20 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate?
The IUPAC name of [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate (CID 156650219) is [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate.
What is the SMILES notation for [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate?
The canonical SMILES for [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate is C=CN(C)/C(=N\C)S/C=C/C(=O)c1cccc(C(F)(F)F)c1.
What is the InChIKey of [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate?
The InChIKey is QQBLFGRUEGMVNW-ZMYBKAFPSA-N. The full InChI is InChI=1S/C15H15F3N2OS/c1-4-20(3)14(19-2)22-9-8-13(21)11-6-5-7-12(10-11)15(16,17)18/h4-10H,1H2,2-3H3/b9-8+,19-14+.
What are the key properties of [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate?
[(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate has a molecular weight of 328.36 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-oxo-3-[3-(trifluoromethyl)phenyl]prop-1-enyl] N-ethenyl-N,N'-dimethylcarbamimidothioate is sourced from PubChem (CID 156650219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).