C18H28N3O3S2+ — CID 156650314
6-(2-methoxy-4-methylsulfonylphenyl)-4-methyl-N-(thiolan-2-ylmethyl)-1,2,3,6-tetrahydropyrazin-4-ium-2-amine (PubChem CID 156650314) has the molecular formula C18H28N3O3S2+ and a molecular weight of 398.57 g/mol. Its IUPAC name is 6-(2-methoxy-4-methylsulfonylphenyl)-4-methyl-N-(thiolan-2-ylmethyl)-1,2,3,6-tetrahydropyrazin-4-ium-2-amine.
| Compound Name | 6-(2-methoxy-4-methylsulfonylphenyl)-4-methyl-N-(thiolan-2-ylmethyl)-1,2,3,6-tetrahydropyrazin-4-ium-2-amine |
|---|---|
| PubChem CID | 156650314 |
| Molecular Formula | C18H28N3O3S2+ |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 6-(2-methoxy-4-methylsulfonylphenyl)-4-methyl-N-(thiolan-2-ylmethyl)-1,2,3,6-tetrahydropyrazin-4-ium-2-amine |
| SMILES | COc1cc(S(C)(=O)=O)ccc1C1C=[N+](C)CC(NCC2CCCS2)N1 |
| InChI | InChI=1S/C18H28N3O3S2/c1-21-11-16(20-18(12-21)19-10-13-5-4-8-25-13)15-7-6-14(26(3,22)23)9-17(15)24-2/h6-7,9,11,13,16,18-20H,4-5,8,10,12H2,1-3H3/q+1 |
| InChIKey | ITGDRWBXHQXBPJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|