About CID 156650322
CID 156650322 (PubChem CID 156650322) has the molecular formula C16H19N2O3S2
and a molecular weight of 351.47 g/mol.
Molecular Properties
| Compound Name | CID 156650322 |
| PubChem CID | 156650322 |
| Molecular Formula | C16H19N2O3S2 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)c1ccc(C2=NC(SC[C@@H]3CCCO3)=CN[CH]2)cc1 |
| InChI | InChI=1S/C16H19N2O3S2/c1-23(19,20)14-6-4-12(5-7-14)15-9-17-10-16(18-15)22-11-13-3-2-8-21-13/h4-7,9-10,13,17H,2-3,8,11H2,1H3/t13-/m0/s1 |
| InChIKey | WGSJWKPCJMIFGM-ZDUSSCGKSA-N |
| XLogP | 2.36 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 156650322 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156650322?
The IUPAC name of CID 156650322 (CID 156650322) is not available.
What is the SMILES notation for CID 156650322?
The canonical SMILES for CID 156650322 is CS(=O)(=O)c1ccc(C2=NC(SC[C@@H]3CCCO3)=CN[CH]2)cc1.
What is the InChIKey of CID 156650322?
The InChIKey is WGSJWKPCJMIFGM-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H19N2O3S2/c1-23(19,20)14-6-4-12(5-7-14)15-9-17-10-16(18-15)22-11-13-3-2-8-21-13/h4-7,9-10,13,17H,2-3,8,11H2,1H3/t13-/m0/s1.
What are the key properties of CID 156650322?
CID 156650322 has a molecular weight of 351.47 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156650322 is sourced from PubChem (CID 156650322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).