C19H19ClN2O5S — CID 156650720
methyl 4-(6-chloro-8-sulfamoyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl)benzoate (PubChem CID 156650720) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is methyl 4-(6-chloro-8-sulfamoyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl)benzoate.
| Compound Name | methyl 4-(6-chloro-8-sulfamoyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl)benzoate |
|---|---|
| PubChem CID | 156650720 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | methyl 4-(6-chloro-8-sulfamoyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2Nc3c(Cl)cc(S(N)(=O)=O)cc3C3OCCC23)cc1 |
| InChI | InChI=1S/C19H19ClN2O5S/c1-26-19(23)11-4-2-10(3-5-11)16-13-6-7-27-18(13)14-8-12(28(21,24)25)9-15(20)17(14)22-16/h2-5,8-9,13,16,18,22H,6-7H2,1H3,(H2,21,24,25) |
| InChIKey | DWGGACSIPHKDON-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |