About CID 156650961
CID 156650961 (PubChem CID 156650961) has the molecular formula C23H20B3N3O5
and a molecular weight of 450.87 g/mol.
Molecular Properties
| Compound Name | CID 156650961 |
| PubChem CID | 156650961 |
| Molecular Formula | C23H20B3N3O5 |
| Molecular Weight | 450.87 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1n[nH]c(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H20B3N3O5/c1-21(2)22(3,4)34-26(33-21)12-9-10-13-16(11-12)17(27-28-18(13)30)23(24,25)29-19(31)14-7-5-6-8-15(14)20(29)32/h5-11H,1-4H3,(H,28,30) |
| InChIKey | GCDLFRRFFDSEFE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.87 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 156650961 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156650961?
The IUPAC name of CID 156650961 (CID 156650961) is not available.
What is the SMILES notation for CID 156650961?
The canonical SMILES for CID 156650961 is [B]C([B])(c1n[nH]c(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc12)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of CID 156650961?
The InChIKey is GCDLFRRFFDSEFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20B3N3O5/c1-21(2)22(3,4)34-26(33-21)12-9-10-13-16(11-12)17(27-28-18(13)30)23(24,25)29-19(31)14-7-5-6-8-15(14)20(29)32/h5-11H,1-4H3,(H,28,30).
What are the key properties of CID 156650961?
CID 156650961 has a molecular weight of 450.87 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156650961 is sourced from PubChem (CID 156650961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).