About ethane;imidazo[1,2-a]pyridine-7-carbaldehyde
ethane;imidazo[1,2-a]pyridine-7-carbaldehyde (PubChem CID 156651569) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is ethane;imidazo[1,2-a]pyridine-7-carbaldehyde.
Molecular Properties
| Compound Name | ethane;imidazo[1,2-a]pyridine-7-carbaldehyde |
| PubChem CID | 156651569 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | ethane;imidazo[1,2-a]pyridine-7-carbaldehyde |
| SMILES | CC.O=Cc1ccn2ccnc2c1 |
| InChI | InChI=1S/C8H6N2O.C2H6/c11-6-7-1-3-10-4-2-9-8(10)5-7;1-2/h1-6H;1-2H3 |
| InChIKey | RESCUAQUJQQHBQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;imidazo[1,2-a]pyridine-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;imidazo[1,2-a]pyridine-7-carbaldehyde?
The IUPAC name of ethane;imidazo[1,2-a]pyridine-7-carbaldehyde (CID 156651569) is ethane;imidazo[1,2-a]pyridine-7-carbaldehyde.
What is the SMILES notation for ethane;imidazo[1,2-a]pyridine-7-carbaldehyde?
The canonical SMILES for ethane;imidazo[1,2-a]pyridine-7-carbaldehyde is CC.O=Cc1ccn2ccnc2c1.
What is the InChIKey of ethane;imidazo[1,2-a]pyridine-7-carbaldehyde?
The InChIKey is RESCUAQUJQQHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.C2H6/c11-6-7-1-3-10-4-2-9-8(10)5-7;1-2/h1-6H;1-2H3.
What are the key properties of ethane;imidazo[1,2-a]pyridine-7-carbaldehyde?
ethane;imidazo[1,2-a]pyridine-7-carbaldehyde has a molecular weight of 176.22 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;imidazo[1,2-a]pyridine-7-carbaldehyde is sourced from PubChem (CID 156651569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).