About ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine
ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine (PubChem CID 156651760) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine.
Molecular Properties
| Compound Name | ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine |
| PubChem CID | 156651760 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine |
| SMILES | CC.[H]/N=C(/CN(C)CC)C(=C)C |
| InChI | InChI=1S/C8H16N2.C2H6/c1-5-10(4)6-8(9)7(2)3;1-2/h9H,2,5-6H2,1,3-4H3;1-2H3/b9-8-; |
| InChIKey | LUGFQELSSOJDGM-UOQXYWCXSA-N |
| XLogP | 2.56 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine?
The IUPAC name of ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine (CID 156651760) is ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine.
What is the SMILES notation for ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine?
The canonical SMILES for ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine is CC.[H]/N=C(/CN(C)CC)C(=C)C.
What is the InChIKey of ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine?
The InChIKey is LUGFQELSSOJDGM-UOQXYWCXSA-N. The full InChI is InChI=1S/C8H16N2.C2H6/c1-5-10(4)6-8(9)7(2)3;1-2/h9H,2,5-6H2,1,3-4H3;1-2H3/b9-8-;.
What are the key properties of ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine?
ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine has a molecular weight of 170.30 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-2-imino-N,3-dimethylbut-3-en-1-amine is sourced from PubChem (CID 156651760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).