C15H26N2O — CID 156652004
ethane;1-[1-(6-methyl-3-pyridinyl)piperidin-4-yl]ethanol (PubChem CID 156652004) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is ethane;1-[1-(6-methyl-3-pyridinyl)piperidin-4-yl]ethanol.
| Compound Name | ethane;1-[1-(6-methyl-3-pyridinyl)piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 156652004 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | ethane;1-[1-(6-methyl-3-pyridinyl)piperidin-4-yl]ethanol |
| SMILES | CC.Cc1ccc(N2CCC(C(C)O)CC2)cn1 |
| InChI | InChI=1S/C13H20N2O.C2H6/c1-10-3-4-13(9-14-10)15-7-5-12(6-8-15)11(2)16;1-2/h3-4,9,11-12,16H,5-8H2,1-2H3;1-2H3 |
| InChIKey | ZNLLUJQAJCJOQU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |