C23H30BBrN4O2 — CID 156652424
3-bromo-2-methylimidazo[1,2-a]pyridine;ethane;3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine (PubChem CID 156652424) has the molecular formula C23H30BBrN4O2 and a molecular weight of 485.24 g/mol. Its IUPAC name is 3-bromo-2-methylimidazo[1,2-a]pyridine;ethane;3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-bromo-2-methylimidazo[1,2-a]pyridine;ethane;3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 156652424 |
| Molecular Formula | C23H30BBrN4O2 |
| Molecular Weight | 485.24 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 3-bromo-2-methylimidazo[1,2-a]pyridine;ethane;3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
| SMILES | CC.CC1(C)OB(c2cnc3ccccn23)OC1(C)C.Cc1nc2ccccn2c1Br |
| InChI | InChI=1S/C13H17BN2O2.C8H7BrN2.C2H6/c1-12(2)13(3,4)18-14(17-12)10-9-15-11-7-5-6-8-16(10)11;1-6-8(9)11-5-3-2-4-7(11)10-6;1-2/h5-9H,1-4H3;2-5H,1H3;1-2H3 |
| InChIKey | YOJSRWVWBGVWQR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|