C24H24ClFN4O2 — CID 156653027
1-[4-[6-chloro-8-fluoro-7-(2-hydroxy-6-propan-2-ylphenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 156653027) has the molecular formula C24H24ClFN4O2 and a molecular weight of 454.93 g/mol. Its IUPAC name is 1-[4-[6-chloro-8-fluoro-7-(2-hydroxy-6-propan-2-ylphenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[6-chloro-8-fluoro-7-(2-hydroxy-6-propan-2-ylphenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156653027 |
| Molecular Formula | C24H24ClFN4O2 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-[4-[6-chloro-8-fluoro-7-(2-hydroxy-6-propan-2-ylphenyl)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(F)c(-c4c(O)cccc4C(C)C)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C24H24ClFN4O2/c1-4-19(32)29-8-10-30(11-9-29)24-16-12-17(25)21(22(26)23(16)27-13-28-24)20-15(14(2)3)6-5-7-18(20)31/h4-7,12-14,31H,1,8-11H2,2-3H3 |
| InChIKey | XKCNFJAFEFHBFX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|