About 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide
2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide (PubChem CID 156653677) has the molecular formula C14H21FN2O
and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide.
Molecular Properties
| Compound Name | 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide |
| PubChem CID | 156653677 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1CC(=O)NN |
| InChI | InChI=1S/C14H21FN2O/c1-8(2)11-5-10(15)6-12(9(3)4)13(11)7-14(18)17-16/h5-6,8-9H,7,16H2,1-4H3,(H,17,18) |
| InChIKey | VCIJQNSVKNBYGQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide?
The IUPAC name of 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide (CID 156653677) is 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide.
What is the SMILES notation for 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide?
The canonical SMILES for 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide is CC(C)c1cc(F)cc(C(C)C)c1CC(=O)NN.
What is the InChIKey of 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide?
The InChIKey is VCIJQNSVKNBYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FN2O/c1-8(2)11-5-10(15)6-12(9(3)4)13(11)7-14(18)17-16/h5-6,8-9H,7,16H2,1-4H3,(H,17,18).
What are the key properties of 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide?
2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide has a molecular weight of 252.33 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]acetohydrazide is sourced from PubChem (CID 156653677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).