C18H25NO2 — CID 156654356
ethyl (2E)-16-azatricyclo[9.4.1.02,10]hexadeca-2,12,14-triene-16-carboxylate (PubChem CID 156654356) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is ethyl (2E)-16-azatricyclo[9.4.1.02,10]hexadeca-2,12,14-triene-16-carboxylate.
| Compound Name | ethyl (2E)-16-azatricyclo[9.4.1.02,10]hexadeca-2,12,14-triene-16-carboxylate |
|---|---|
| PubChem CID | 156654356 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | ethyl (2E)-16-azatricyclo[9.4.1.02,10]hexadeca-2,12,14-triene-16-carboxylate |
| SMILES | CCOC(=O)N1C2C=CC=CC1C1CCCCCC/C=C\12 |
| InChI | InChI=1S/C18H25NO2/c1-2-21-18(20)19-16-12-8-9-13-17(19)15-11-7-5-3-4-6-10-14(15)16/h8-10,12-13,15-17H,2-7,11H2,1H3/b14-10+ |
| InChIKey | FXRMRVWFWYFAIY-GXDHUFHOSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|