C11H17F3OS — CID 156654390
(1S)-1-[(1S,2R,3S,5R)-6,6-dimethyl-3-sulfanyl-2-bicyclo[3.1.1]heptanyl]-2,2,2-trifluoroethanol (PubChem CID 156654390) has the molecular formula C11H17F3OS and a molecular weight of 254.32 g/mol. Its IUPAC name is (1S)-1-[(1S,2R,3S,5R)-6,6-dimethyl-3-sulfanyl-2-bicyclo[3.1.1]heptanyl]-2,2,2-trifluoroethanol.
| Compound Name | (1S)-1-[(1S,2R,3S,5R)-6,6-dimethyl-3-sulfanyl-2-bicyclo[3.1.1]heptanyl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 156654390 |
| Molecular Formula | C11H17F3OS |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (1S)-1-[(1S,2R,3S,5R)-6,6-dimethyl-3-sulfanyl-2-bicyclo[3.1.1]heptanyl]-2,2,2-trifluoroethanol |
| SMILES | CC1(C)[C@H]2C[C@H](S)[C@@H]([C@H](O)C(F)(F)F)[C@@H]1C2 |
| InChI | InChI=1S/C11H17F3OS/c1-10(2)5-3-6(10)8(7(16)4-5)9(15)11(12,13)14/h5-9,15-16H,3-4H2,1-2H3/t5-,6+,7+,8+,9+/m1/s1 |
| InChIKey | VDQNFUCVROLQBF-QVWMKHDWSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|