C20H30O4 — CID 156654652
tert-butyl 2-[(2R,8R,8aS)-3-acetyloxy-8,8a-dimethyl-2,6,7,8-tetrahydro-1H-naphthalen-2-yl]acetate (PubChem CID 156654652) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl 2-[(2R,8R,8aS)-3-acetyloxy-8,8a-dimethyl-2,6,7,8-tetrahydro-1H-naphthalen-2-yl]acetate.
| Compound Name | tert-butyl 2-[(2R,8R,8aS)-3-acetyloxy-8,8a-dimethyl-2,6,7,8-tetrahydro-1H-naphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 156654652 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | tert-butyl 2-[(2R,8R,8aS)-3-acetyloxy-8,8a-dimethyl-2,6,7,8-tetrahydro-1H-naphthalen-2-yl]acetate |
| SMILES | CC(=O)OC1=CC2=CCC[C@@H](C)[C@]2(C)C[C@@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30O4/c1-13-8-7-9-16-11-17(23-14(2)21)15(12-20(13,16)6)10-18(22)24-19(3,4)5/h9,11,13,15H,7-8,10,12H2,1-6H3/t13-,15+,20+/m1/s1 |
| InChIKey | MBWIREGTABCVLT-AFBRZQFHSA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |