About S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate
S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate (PubChem CID 156654721) has the molecular formula C17H20FNO4S
and a molecular weight of 353.42 g/mol. Its IUPAC name is S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate.
Molecular Properties
| Compound Name | S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate |
| PubChem CID | 156654721 |
| Molecular Formula | C17H20FNO4S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate |
| SMILES | CC(=O)S[C@H](C)CNc1coc2c(F)c(C)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C17H20FNO4S/c1-9(24-11(3)20)7-19-14-8-23-16-13(14)6-12(10(2)15(16)18)17-21-4-5-22-17/h6,8-9,17,19H,4-5,7H2,1-3H3/t9-/m1/s1 |
| InChIKey | SRLBEVIGQGUPBZ-SECBINFHSA-N |
| XLogP | 4.01 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate?
The IUPAC name of S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate (CID 156654721) is S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate.
What is the SMILES notation for S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate?
The canonical SMILES for S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate is CC(=O)S[C@H](C)CNc1coc2c(F)c(C)c(C3OCCO3)cc12.
What is the InChIKey of S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate?
The InChIKey is SRLBEVIGQGUPBZ-SECBINFHSA-N. The full InChI is InChI=1S/C17H20FNO4S/c1-9(24-11(3)20)7-19-14-8-23-16-13(14)6-12(10(2)15(16)18)17-21-4-5-22-17/h6,8-9,17,19H,4-5,7H2,1-3H3/t9-/m1/s1.
What are the key properties of S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate?
S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate has a molecular weight of 353.42 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2R)-1-[[5-(1,3-dioxolan-2-yl)-7-fluoro-6-methyl-1-benzofuran-3-yl]amino]propan-2-yl] ethanethioate is sourced from PubChem (CID 156654721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).