About 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine
4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine (PubChem CID 156655122) has the molecular formula C32H30IrN2-2
and a molecular weight of 634.82 g/mol. Its IUPAC name is 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine.
Molecular Properties
| Compound Name | 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine |
| PubChem CID | 156655122 |
| Molecular Formula | C32H30IrN2-2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccccc1-c1cc(C23CC4CC(CC(C4)C2)C3)ccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C21H22N.C11H8N.Ir/c1-2-4-18(5-3-1)20-11-19(6-7-22-20)21-12-15-8-16(13-21)10-17(9-15)14-21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-4,6-7,11,15-17H,8-10,12-14H2;1-6,8-9H;/q2*-1; |
| InChIKey | VOMRSGWSHHUBRK-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine?
The IUPAC name of 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine (CID 156655122) is 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine.
What is the SMILES notation for 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine?
The canonical SMILES for 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine is [Ir].[c-]1ccccc1-c1cc(C23CC4CC(CC(C4)C2)C3)ccn1.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine?
The InChIKey is VOMRSGWSHHUBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N.C11H8N.Ir/c1-2-4-18(5-3-1)20-11-19(6-7-22-20)21-12-15-8-16(13-21)10-17(9-15)14-21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-4,6-7,11,15-17H,8-10,12-14H2;1-6,8-9H;/q2*-1;.
What are the key properties of 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine?
4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine has a molecular weight of 634.82 g/mol, XLogP of 7.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantyl)-2-phenylpyridine;iridium;2-phenylpyridine is sourced from PubChem (CID 156655122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).