About CID 156655378
CID 156655378 (PubChem CID 156655378) has the molecular formula C30H27IrN3O3P-
and a molecular weight of 700.76 g/mol.
Molecular Properties
| Compound Name | CID 156655378 |
| PubChem CID | 156655378 |
| Molecular Formula | C30H27IrN3O3P- |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 701.14 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.CN1c2[c-]c(-c3ccccn3)cc3c2P(=O)(c2ccccc21)c1ccccc1N3C.[Ir] |
| InChI | InChI=1S/C25H19N3OP.C5H8O2.Ir/c1-27-19-10-3-5-12-23(19)30(29)24-13-6-4-11-20(24)28(2)22-16-17(15-21(27)25(22)30)18-9-7-8-14-26-18;1-4(6)3-5(2)7;/h3-15H,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | SMAISJOLFRWHLJ-LWFKIUJUSA-N |
| XLogP | 5.39 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 156655378 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156655378?
The IUPAC name of CID 156655378 (CID 156655378) is not available.
What is the SMILES notation for CID 156655378?
The canonical SMILES for CID 156655378 is CC(=O)/C=C(/C)O.CN1c2[c-]c(-c3ccccn3)cc3c2P(=O)(c2ccccc21)c1ccccc1N3C.[Ir].
What is the InChIKey of CID 156655378?
The InChIKey is SMAISJOLFRWHLJ-LWFKIUJUSA-N. The full InChI is InChI=1S/C25H19N3OP.C5H8O2.Ir/c1-27-19-10-3-5-12-23(19)30(29)24-13-6-4-11-20(24)28(2)22-16-17(15-21(27)25(22)30)18-9-7-8-14-26-18;1-4(6)3-5(2)7;/h3-15H,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of CID 156655378?
CID 156655378 has a molecular weight of 700.76 g/mol, XLogP of 5.39, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156655378 is sourced from PubChem (CID 156655378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).