About CID 156655513
CID 156655513 (PubChem CID 156655513) has the molecular formula C22H12IrN2OPS2-
and a molecular weight of 607.68 g/mol.
Molecular Properties
| Compound Name | CID 156655513 |
| PubChem CID | 156655513 |
| Molecular Formula | C22H12IrN2OPS2- |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 607.98 |
| IUPAC Name | — |
| SMILES | O=P12c3ccccc3Sc3[c-]c(-c4cnccn4)cc(c31)Sc1ccccc12.[Ir] |
| InChI | InChI=1S/C22H12N2OPS2.Ir/c25-26-16-5-1-3-7-18(16)27-20-11-14(15-13-23-9-10-24-15)12-21(22(20)26)28-19-8-4-2-6-17(19)26;/h1-11,13H;/q-1; |
| InChIKey | OYXWAQAPFZCLQC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 156655513 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156655513?
The IUPAC name of CID 156655513 (CID 156655513) is not available.
What is the SMILES notation for CID 156655513?
The canonical SMILES for CID 156655513 is O=P12c3ccccc3Sc3[c-]c(-c4cnccn4)cc(c31)Sc1ccccc12.[Ir].
What is the InChIKey of CID 156655513?
The InChIKey is OYXWAQAPFZCLQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12N2OPS2.Ir/c25-26-16-5-1-3-7-18(16)27-20-11-14(15-13-23-9-10-24-15)12-21(22(20)26)28-19-8-4-2-6-17(19)26;/h1-11,13H;/q-1;.
What are the key properties of CID 156655513?
CID 156655513 has a molecular weight of 607.68 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156655513 is sourced from PubChem (CID 156655513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).