About CID 156655612
CID 156655612 (PubChem CID 156655612) has the molecular formula C44H39IrN2O2Si2-
and a molecular weight of 876.20 g/mol.
Molecular Properties
| Compound Name | CID 156655612 |
| PubChem CID | 156655612 |
| Molecular Formula | C44H39IrN2O2Si2- |
| Molecular Weight | 876.20 g/mol |
| Exact Mass | 876.22 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.C[Si]1(C)c2[c-]c(-c3ccc4ccccc4n3)cc3c2N(c2cc4ccccc4cc21)c1cc2ccccc2cc1[Si]3(C)C.[Ir] |
| InChI | InChI=1S/C39H31N2Si2.C5H8O2.Ir/c1-42(2)35-21-28-14-7-5-12-26(28)19-33(35)41-34-20-27-13-6-8-15-29(27)22-36(34)43(3,4)38-24-30(23-37(42)39(38)41)32-18-17-25-11-9-10-16-31(25)40-32;1-4(6)3-5(2)7;/h5-23H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | VQLQOJVJANDARQ-LWFKIUJUSA-N |
| XLogP | 8.78 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 876.20 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 156655612 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156655612?
The IUPAC name of CID 156655612 (CID 156655612) is not available.
What is the SMILES notation for CID 156655612?
The canonical SMILES for CID 156655612 is CC(=O)/C=C(/C)O.C[Si]1(C)c2[c-]c(-c3ccc4ccccc4n3)cc3c2N(c2cc4ccccc4cc21)c1cc2ccccc2cc1[Si]3(C)C.[Ir].
What is the InChIKey of CID 156655612?
The InChIKey is VQLQOJVJANDARQ-LWFKIUJUSA-N. The full InChI is InChI=1S/C39H31N2Si2.C5H8O2.Ir/c1-42(2)35-21-28-14-7-5-12-26(28)19-33(35)41-34-20-27-13-6-8-15-29(27)22-36(34)43(3,4)38-24-30(23-37(42)39(38)41)32-18-17-25-11-9-10-16-31(25)40-32;1-4(6)3-5(2)7;/h5-23H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of CID 156655612?
CID 156655612 has a molecular weight of 876.20 g/mol, XLogP of 8.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156655612 is sourced from PubChem (CID 156655612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).