About CID 156655622
CID 156655622 (PubChem CID 156655622) has the molecular formula C24H18IrN4P-
and a molecular weight of 585.63 g/mol.
Molecular Properties
| Compound Name | CID 156655622 |
| PubChem CID | 156655622 |
| Molecular Formula | C24H18IrN4P- |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | — |
| SMILES | CN1c2[c-]c(-c3cnccn3)cc3c2P(c2ccccc21)c1ccccc1N3C.[Ir] |
| InChI | InChI=1S/C24H18N4P.Ir/c1-27-18-7-3-5-9-22(18)29-23-10-6-4-8-19(23)28(2)21-14-16(13-20(27)24(21)29)17-15-25-11-12-26-17;/h3-13,15H,1-2H3;/q-1; |
| InChIKey | XSNHGUJPKDPVFO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 156655622 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156655622?
The IUPAC name of CID 156655622 (CID 156655622) is not available.
What is the SMILES notation for CID 156655622?
The canonical SMILES for CID 156655622 is CN1c2[c-]c(-c3cnccn3)cc3c2P(c2ccccc21)c1ccccc1N3C.[Ir].
What is the InChIKey of CID 156655622?
The InChIKey is XSNHGUJPKDPVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N4P.Ir/c1-27-18-7-3-5-9-22(18)29-23-10-6-4-8-19(23)28(2)21-14-16(13-20(27)24(21)29)17-15-25-11-12-26-17;/h3-13,15H,1-2H3;/q-1;.
What are the key properties of CID 156655622?
CID 156655622 has a molecular weight of 585.63 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156655622 is sourced from PubChem (CID 156655622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).