C40H44NOP — CID 156656687
[(3R)-4'-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4-yl]-diphenylphosphane (PubChem CID 156656687) has the molecular formula C40H44NOP and a molecular weight of 585.77 g/mol. Its IUPAC name is [(3R)-4'-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4-yl]-diphenylphosphane.
| Compound Name | [(3R)-4'-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 156656687 |
| Molecular Formula | C40H44NOP |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | [(3R)-4'-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4-yl]-diphenylphosphane |
| SMILES | CC1(C)C[C@@]2(CC(C)(C)c3cccc(P(c4ccccc4)c4ccccc4)c32)c2c(C3=N[C@@H](C(C)(C)C)CO3)cccc21 |
| InChI | InChI=1S/C40H44NOP/c1-37(2,3)33-24-42-36(41-33)29-20-14-21-30-34(29)40(25-38(30,4)5)26-39(6,7)31-22-15-23-32(35(31)40)43(27-16-10-8-11-17-27)28-18-12-9-13-19-28/h8-23,33H,24-26H2,1-7H3/t33-,40-/m1/s1 |
| InChIKey | XYDZSGKQCCOSIW-TUYDZOLPSA-N |
| XLogP | 8.28 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|