C51H55IrN3OSi-2 — CID 156657460
[6-(4-tert-butylbenzene-6-id-1-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane;1-(2-tert-butylphenyl)-2-(3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium (PubChem CID 156657460) has the molecular formula C51H55IrN3OSi-2 and a molecular weight of 946.32 g/mol. Its IUPAC name is [6-(4-tert-butylbenzene-6-id-1-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane;1-(2-tert-butylphenyl)-2-(3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium.
| Compound Name | [6-(4-tert-butylbenzene-6-id-1-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane;1-(2-tert-butylphenyl)-2-(3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium |
|---|---|
| PubChem CID | 156657460 |
| Molecular Formula | C51H55IrN3OSi-2 |
| Molecular Weight | 946.32 g/mol |
| Exact Mass | 946.38 |
| IUPAC Name | [6-(4-tert-butylbenzene-6-id-1-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane;1-(2-tert-butylphenyl)-2-(3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium |
| SMILES | CC(C)(C)c1ccccc1-n1c(-c2[c-]ccc3c2oc2ccccc23)nc2ccccc21.CC(C)Cc1cc(-c2[c-]cc(C(C)(C)C)cc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C29H23N2O.C22H32NSi.Ir/c1-29(2,3)22-14-5-7-16-24(22)31-25-17-8-6-15-23(25)30-28(31)21-13-10-12-20-19-11-4-9-18-26(19)32-27(20)21;1-16(2)13-18-14-20(23-15-21(18)24(6,7)8)17-9-11-19(12-10-17)22(3,4)5;/h4-12,14-18H,1-3H3;9,11-12,14-16H,13H2,1-8H3;/q2*-1; |
| InChIKey | ADELVVNQPMYRTH-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.32 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|