C57H55GeIrN3S-2 — CID 156657486
CID 156657486 (PubChem CID 156657486) has the molecular formula C57H55GeIrN3S-2 and a molecular weight of 1078.98 g/mol.
| Compound Name | CID 156657486 |
|---|---|
| PubChem CID | 156657486 |
| Molecular Formula | C57H55GeIrN3S-2 |
| Molecular Weight | 1078.98 g/mol |
| Exact Mass | 1080.30 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]ccc3c2sc2cc4ccc5ccccc5c4cc23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C39H31N2S.C18H24GeN.Ir/c1-23(2)27-13-9-14-28(24(3)4)37(27)41-35-18-8-7-17-34(35)40-39(41)31-16-10-15-30-33-22-32-26(21-36(33)42-38(30)31)20-19-25-11-5-6-12-29(25)32;1-14(2)11-16-12-18(15-9-7-6-8-10-15)20-13-17(16)19(3,4)5;/h5-15,17-24H,1-4H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | XBGVZJJPMZGFEM-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.98 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|