C50H36F3GeIrN3O-2 — CID 156657576
iridium;1-(2-phenylphenyl)-2-[7-(trifluoromethyl)-9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl]benzimidazole;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 156657576) has the molecular formula C50H36F3GeIrN3O-2 and a molecular weight of 1016.68 g/mol. Its IUPAC name is iridium;1-(2-phenylphenyl)-2-[7-(trifluoromethyl)-9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl]benzimidazole;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | iridium;1-(2-phenylphenyl)-2-[7-(trifluoromethyl)-9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl]benzimidazole;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 156657576 |
| Molecular Formula | C50H36F3GeIrN3O-2 |
| Molecular Weight | 1016.68 g/mol |
| Exact Mass | 1018.17 |
| IUPAC Name | iridium;1-(2-phenylphenyl)-2-[7-(trifluoromethyl)-9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl]benzimidazole;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.FC(F)(F)c1c[c-]c(-c2nc3ccccc3n2-c2ccccc2-c2ccccc2)c2oc3c4ccccc4ccc3c12.[Ir] |
| InChI | InChI=1S/C36H20F3N2O.C14H16GeN.Ir/c37-36(38,39)28-21-20-27(34-32(28)26-19-18-23-12-4-5-14-25(23)33(26)42-34)35-40-29-15-7-9-17-31(29)41(35)30-16-8-6-13-24(30)22-10-2-1-3-11-22;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h1-19,21H;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | IKJZVQBPYREQLW-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.68 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|