C51H45IrN3OSi-2 — CID 156658076
[4-(cyclopentylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-(3H-dibenzofuran-3-id-4-yl)-1-(2-phenylphenyl)benzimidazole;iridium (PubChem CID 156658076) has the molecular formula C51H45IrN3OSi-2 and a molecular weight of 936.24 g/mol. Its IUPAC name is [4-(cyclopentylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-(3H-dibenzofuran-3-id-4-yl)-1-(2-phenylphenyl)benzimidazole;iridium.
| Compound Name | [4-(cyclopentylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-(3H-dibenzofuran-3-id-4-yl)-1-(2-phenylphenyl)benzimidazole;iridium |
|---|---|
| PubChem CID | 156658076 |
| Molecular Formula | C51H45IrN3OSi-2 |
| Molecular Weight | 936.24 g/mol |
| Exact Mass | 936.30 |
| IUPAC Name | [4-(cyclopentylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;2-(3H-dibenzofuran-3-id-4-yl)-1-(2-phenylphenyl)benzimidazole;iridium |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1CC1CCCC1.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1nc2ccccc2n1-c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C31H19N2O.C20H26NSi.Ir/c1-2-11-21(12-3-1)22-13-4-7-18-27(22)33-28-19-8-6-17-26(28)32-31(33)25-16-10-15-24-23-14-5-9-20-29(23)34-30(24)25;1-22(2,3)20-15-21-19(17-11-5-4-6-12-17)14-18(20)13-16-9-7-8-10-16;/h1-15,17-20H;4-6,11,14-16H,7-10,13H2,1-3H3;/q2*-1; |
| InChIKey | UKZUHHCCLSRGBO-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.24 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|