C54H49IrN3Si-2 — CID 156658598
2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-3-naphthalen-1-ylbenzo[f]benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 156658598) has the molecular formula C54H49IrN3Si-2 and a molecular weight of 960.31 g/mol. Its IUPAC name is 2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-3-naphthalen-1-ylbenzo[f]benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-3-naphthalen-1-ylbenzo[f]benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 156658598 |
| Molecular Formula | C54H49IrN3Si-2 |
| Molecular Weight | 960.31 g/mol |
| Exact Mass | 960.33 |
| IUPAC Name | 2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-3-naphthalen-1-ylbenzo[f]benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CC1(C)c2c[c-]c(-c3nc4cc5ccccc5cc4n3-c3cccc4ccccc34)cc2-c2ccccc21.[Ir] |
| InChI | InChI=1S/C36H25N2.C18H24NSi.Ir/c1-36(2)30-16-8-7-15-28(30)29-20-26(18-19-31(29)36)35-37-32-21-24-11-3-4-12-25(24)22-34(32)38(35)33-17-9-13-23-10-5-6-14-27(23)33;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h3-17,19-22H,1-2H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | VWVQKMHDYDALGB-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.31 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|