C49H50FIrN3OSi-2 — CID 156658636
2-(1-fluoro-7-propan-2-yl-3H-dibenzofuran-3-id-4-yl)-1-(2,4,6-trimethylphenyl)benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 156658636) has the molecular formula C49H50FIrN3OSi-2 and a molecular weight of 936.26 g/mol. Its IUPAC name is 2-(1-fluoro-7-propan-2-yl-3H-dibenzofuran-3-id-4-yl)-1-(2,4,6-trimethylphenyl)benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 2-(1-fluoro-7-propan-2-yl-3H-dibenzofuran-3-id-4-yl)-1-(2,4,6-trimethylphenyl)benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 156658636 |
| Molecular Formula | C49H50FIrN3OSi-2 |
| Molecular Weight | 936.26 g/mol |
| Exact Mass | 936.33 |
| IUPAC Name | 2-(1-fluoro-7-propan-2-yl-3H-dibenzofuran-3-id-4-yl)-1-(2,4,6-trimethylphenyl)benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1cc(C)c(-n2c(-c3[c-]cc(F)c4c3oc3cc(C(C)C)ccc34)nc3ccccc32)c(C)c1.[Ir] |
| InChI | InChI=1S/C31H26FN2O.C18H24NSi.Ir/c1-17(2)21-10-11-22-27(16-21)35-30-23(12-13-24(32)28(22)30)31-33-25-8-6-7-9-26(25)34(31)29-19(4)14-18(3)15-20(29)5;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h6-11,13-17H,1-5H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | PCZAWKPGPMAPLU-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.26 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|