C49H35GeIrN3OS-2 — CID 156658780
3-dibenzofuran-4-yl-2-(3H-dibenzothiophen-3-id-4-yl)benzo[f]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 156658780) has the molecular formula C49H35GeIrN3OS-2 and a molecular weight of 978.73 g/mol. Its IUPAC name is 3-dibenzofuran-4-yl-2-(3H-dibenzothiophen-3-id-4-yl)benzo[f]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 3-dibenzofuran-4-yl-2-(3H-dibenzothiophen-3-id-4-yl)benzo[f]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 156658780 |
| Molecular Formula | C49H35GeIrN3OS-2 |
| Molecular Weight | 978.73 g/mol |
| Exact Mass | 980.14 |
| IUPAC Name | 3-dibenzofuran-4-yl-2-(3H-dibenzothiophen-3-id-4-yl)benzo[f]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1ccc2c(sc3ccccc32)c1-c1nc2cc3ccccc3cc2n1-c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C35H19N2OS.C14H16GeN.Ir/c1-2-10-22-20-30-28(19-21(22)9-1)36-35(27-15-7-14-26-24-12-4-6-18-32(24)39-34(26)27)37(30)29-16-8-13-25-23-11-3-5-17-31(23)38-33(25)29;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h1-14,16-20H;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | IZHUEAYMJKNVGV-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.73 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|