C52H36IrN4OSSi-2 — CID 156659512
4-[4-(1-dibenzofuran-4-ylbenzimidazol-2-yl)-3H-dibenzothiophen-3-id-1-yl]benzonitrile;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 156659512) has the molecular formula C52H36IrN4OSSi-2 and a molecular weight of 985.26 g/mol. Its IUPAC name is 4-[4-(1-dibenzofuran-4-ylbenzimidazol-2-yl)-3H-dibenzothiophen-3-id-1-yl]benzonitrile;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-[4-(1-dibenzofuran-4-ylbenzimidazol-2-yl)-3H-dibenzothiophen-3-id-1-yl]benzonitrile;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 156659512 |
| Molecular Formula | C52H36IrN4OSSi-2 |
| Molecular Weight | 985.26 g/mol |
| Exact Mass | 985.20 |
| IUPAC Name | 4-[4-(1-dibenzofuran-4-ylbenzimidazol-2-yl)-3H-dibenzothiophen-3-id-1-yl]benzonitrile;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.N#Cc1ccc(-c2c[c-]c(-c3nc4ccccc4n3-c3cccc4c3oc3ccccc34)c3sc4ccccc4c23)cc1.[Ir] |
| InChI | InChI=1S/C38H20N3OS.C14H16NSi.Ir/c39-22-23-16-18-24(19-17-23)25-20-21-29(37-35(25)28-9-2-6-15-34(28)43-37)38-40-30-11-3-4-12-31(30)41(38)32-13-7-10-27-26-8-1-5-14-33(26)42-36(27)32;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h1-20H;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | JYBSYNDOZWMGAN-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.26 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|