C40H33IrN3OSi-2 — CID 156660698
2-(2H-dibenzofuran-2-id-3-yl)-1-phenylbenzimidazole;iridium;trimethyl-[6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane (PubChem CID 156660698) has the molecular formula C40H33IrN3OSi-2 and a molecular weight of 795.05 g/mol. Its IUPAC name is 2-(2H-dibenzofuran-2-id-3-yl)-1-phenylbenzimidazole;iridium;trimethyl-[6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane.
| Compound Name | 2-(2H-dibenzofuran-2-id-3-yl)-1-phenylbenzimidazole;iridium;trimethyl-[6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane |
|---|---|
| PubChem CID | 156660698 |
| Molecular Formula | C40H33IrN3OSi-2 |
| Molecular Weight | 795.05 g/mol |
| Exact Mass | 795.22 |
| IUPAC Name | 2-(2H-dibenzofuran-2-id-3-yl)-1-phenylbenzimidazole;iridium;trimethyl-[6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc([Si](C)(C)C)cn2)cc1.[Ir].[c-]1cc2c(cc1-c1nc3ccccc3n1-c1ccccc1)oc1ccccc12 |
| InChI | InChI=1S/C25H15N2O.C15H18NSi.Ir/c1-2-8-18(9-3-1)27-22-12-6-5-11-21(22)26-25(27)17-14-15-20-19-10-4-7-13-23(19)28-24(20)16-17;1-12-5-7-13(8-6-12)15-10-9-14(11-16-15)17(2,3)4;/h1-13,15-16H;5-7,9-11H,1-4H3;/q2*-1;/i;1D3; |
| InChIKey | JKTOHTWZRMKJGB-ICMJTWPQSA-N |
| XLogP | 9.79 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.05 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|