C41H28N2 — CID 156661500
3-(9-naphthalen-2-ylcarbazol-3-yl)-9-[4-(trideuteriomethyl)phenyl]carbazole (PubChem CID 156661500) has the molecular formula C41H28N2 and a molecular weight of 551.71 g/mol. Its IUPAC name is 3-(9-naphthalen-2-ylcarbazol-3-yl)-9-[4-(trideuteriomethyl)phenyl]carbazole.
| Compound Name | 3-(9-naphthalen-2-ylcarbazol-3-yl)-9-[4-(trideuteriomethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 156661500 |
| Molecular Formula | C41H28N2 |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 3-(9-naphthalen-2-ylcarbazol-3-yl)-9-[4-(trideuteriomethyl)phenyl]carbazole |
| SMILES | [2H]C([2H])([2H])c1ccc(-n2c3ccccc3c3cc(-c4ccc5c(c4)c4ccccc4n5-c4ccc5ccccc5c4)ccc32)cc1 |
| InChI | InChI=1S/C41H28N2/c1-27-14-19-32(20-15-27)42-38-12-6-4-10-34(38)36-25-30(17-22-40(36)42)31-18-23-41-37(26-31)35-11-5-7-13-39(35)43(41)33-21-16-28-8-2-3-9-29(28)24-33/h2-26H,1H3/i1D3 |
| InChIKey | DVHIDWAJPZWHCY-FIBGUPNXSA-N |
| XLogP | 11.01 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |