C28H31N4+ — CID 156661731
7,7-dimethyl-3-[3-(7-methyl-7-methyl-1,4,5,6-tetrahydroindazol-3-yl)naphthalen-1-yl]-1,4,5,6-tetrahydroindazole (PubChem CID 156661731) has the molecular formula C28H31N4+ and a molecular weight of 423.58 g/mol. Its IUPAC name is 7,7-dimethyl-3-[3-(7-methyl-7-methyl-1,4,5,6-tetrahydroindazol-3-yl)naphthalen-1-yl]-1,4,5,6-tetrahydroindazole.
| Compound Name | 7,7-dimethyl-3-[3-(7-methyl-7-methyl-1,4,5,6-tetrahydroindazol-3-yl)naphthalen-1-yl]-1,4,5,6-tetrahydroindazole |
|---|---|
| PubChem CID | 156661731 |
| Molecular Formula | C28H31N4+ |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 7,7-dimethyl-3-[3-(7-methyl-7-methyl-1,4,5,6-tetrahydroindazol-3-yl)naphthalen-1-yl]-1,4,5,6-tetrahydroindazole |
| SMILES | [CH2+]C1(C)CCCc2c(-c3cc(-c4n[nH]c5c4CCCC5(C)C)c4ccccc4c3)n[nH]c21 |
| InChI | InChI=1S/C28H31N4/c1-27(2)13-7-11-20-23(29-31-25(20)27)18-15-17-9-5-6-10-19(17)22(16-18)24-21-12-8-14-28(3,4)26(21)32-30-24/h5-6,9-10,15-16H,1,7-8,11-14H2,2-4H3,(H,29,31)(H,30,32)/q+1 |
| InChIKey | LGOIVCLUYLTCKY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|