C27H27BClN6O3 — CID 156662281
CID 156662281 (PubChem CID 156662281) has the molecular formula C27H27BClN6O3 and a molecular weight of 529.82 g/mol.
| Compound Name | CID 156662281 |
|---|---|
| PubChem CID | 156662281 |
| Molecular Formula | C27H27BClN6O3 |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | — |
| SMILES | COc1cc(N2CCC(O)C2)c(Cl)cc1Nc1nccc(-c2cc(C#N)c3c(c2)C(C)(C)CN3[B]C=O)n1 |
| InChI | InChI=1S/C27H27BClN6O3/c1-27(2)14-35(28-15-36)25-17(12-30)8-16(9-19(25)27)21-4-6-31-26(32-21)33-22-10-20(29)23(11-24(22)38-3)34-7-5-18(37)13-34/h4,6,8-11,15,18,37H,5,7,13-14H2,1-3H3,(H,31,32,33) |
| InChIKey | CWXJPJCSDGPVBF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|