About lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate
lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate (PubChem CID 156663449) has the molecular formula C7H12F2LiNO3S
and a molecular weight of 235.18 g/mol. Its IUPAC name is lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate.
Molecular Properties
| Compound Name | lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate |
| PubChem CID | 156663449 |
| Molecular Formula | C7H12F2LiNO3S |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate |
| SMILES | CN(CC1CCCC1(F)F)S(=O)(=O)[O-].[Li+] |
| InChI | InChI=1S/C7H13F2NO3S.Li/c1-10(14(11,12)13)5-6-3-2-4-7(6,8)9;/h6H,2-5H2,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | KVGXMJRKEHTRHC-UHFFFAOYSA-M |
| XLogP | -2.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate?
The IUPAC name of lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate (CID 156663449) is lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate.
What is the SMILES notation for lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate?
The canonical SMILES for lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate is CN(CC1CCCC1(F)F)S(=O)(=O)[O-].[Li+].
What is the InChIKey of lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate?
The InChIKey is KVGXMJRKEHTRHC-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13F2NO3S.Li/c1-10(14(11,12)13)5-6-3-2-4-7(6,8)9;/h6H,2-5H2,1H3,(H,11,12,13);/q;+1/p-1.
What are the key properties of lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate?
lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate has a molecular weight of 235.18 g/mol, XLogP of -2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium N-[(2,2-difluorocyclopentyl)methyl]-N-methylsulfamate is sourced from PubChem (CID 156663449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).