C10H15F3O — CID 15666354
(2E,5E)-3,5-dimethyl-4-(trifluoromethyl)hepta-2,5-dien-4-ol (PubChem CID 15666354) has the molecular formula C10H15F3O and a molecular weight of 208.22 g/mol. Its IUPAC name is (2E,5E)-3,5-dimethyl-4-(trifluoromethyl)hepta-2,5-dien-4-ol.
| Compound Name | (2E,5E)-3,5-dimethyl-4-(trifluoromethyl)hepta-2,5-dien-4-ol |
|---|---|
| PubChem CID | 15666354 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2E,5E)-3,5-dimethyl-4-(trifluoromethyl)hepta-2,5-dien-4-ol |
| SMILES | C/C=C(\C)C(O)(/C(C)=C/C)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O/c1-5-7(3)9(14,8(4)6-2)10(11,12)13/h5-6,14H,1-4H3/b7-5+,8-6+ |
| InChIKey | INASIOZDCZNXLQ-KQQUZDAGSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|