About 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene
4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene (PubChem CID 15666361) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene.
Molecular Properties
| Compound Name | 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene |
| PubChem CID | 15666361 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene |
| SMILES | C=CC(=C)C(CC(C)CCCC(C)C)OC |
| InChI | InChI=1S/C15H28O/c1-7-14(5)15(16-6)11-13(4)10-8-9-12(2)3/h7,12-13,15H,1,5,8-11H2,2-4,6H3 |
| InChIKey | HMUGMBILKCZJNZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene?
The IUPAC name of 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene (CID 15666361) is 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene.
What is the SMILES notation for 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene?
The canonical SMILES for 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene is C=CC(=C)C(CC(C)CCCC(C)C)OC.
What is the InChIKey of 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene?
The InChIKey is HMUGMBILKCZJNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O/c1-7-14(5)15(16-6)11-13(4)10-8-9-12(2)3/h7,12-13,15H,1,5,8-11H2,2-4,6H3.
What are the key properties of 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene?
4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene has a molecular weight of 224.39 g/mol, XLogP of 4.60, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6,10-dimethyl-3-methylideneundec-1-ene is sourced from PubChem (CID 15666361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).