C12H20O5S2 — CID 156663630
2-(1-adamantylsulfonyl)ethanesulfonic acid (PubChem CID 156663630) has the molecular formula C12H20O5S2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-(1-adamantylsulfonyl)ethanesulfonic acid.
| Compound Name | 2-(1-adamantylsulfonyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 156663630 |
| Molecular Formula | C12H20O5S2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(1-adamantylsulfonyl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCS(=O)(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H20O5S2/c13-18(14,1-2-19(15,16)17)12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,1-8H2,(H,15,16,17) |
| InChIKey | MYXDPDYFONHGLE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|