About chlorosulfonyl pyrrolidine-1-carboxylate
chlorosulfonyl pyrrolidine-1-carboxylate (PubChem CID 156663996) has the molecular formula C5H8ClNO4S
and a molecular weight of 213.64 g/mol. Its IUPAC name is chlorosulfonyl pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | chlorosulfonyl pyrrolidine-1-carboxylate |
| PubChem CID | 156663996 |
| Molecular Formula | C5H8ClNO4S |
| Molecular Weight | 213.64 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | chlorosulfonyl pyrrolidine-1-carboxylate |
| SMILES | O=C(OS(=O)(=O)Cl)N1CCCC1 |
| InChI | InChI=1S/C5H8ClNO4S/c6-12(9,10)11-5(8)7-3-1-2-4-7/h1-4H2 |
| InChIKey | NTPVRKYSNWSFOP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.64 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze chlorosulfonyl pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosulfonyl pyrrolidine-1-carboxylate?
The IUPAC name of chlorosulfonyl pyrrolidine-1-carboxylate (CID 156663996) is chlorosulfonyl pyrrolidine-1-carboxylate.
What is the SMILES notation for chlorosulfonyl pyrrolidine-1-carboxylate?
The canonical SMILES for chlorosulfonyl pyrrolidine-1-carboxylate is O=C(OS(=O)(=O)Cl)N1CCCC1.
What is the InChIKey of chlorosulfonyl pyrrolidine-1-carboxylate?
The InChIKey is NTPVRKYSNWSFOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClNO4S/c6-12(9,10)11-5(8)7-3-1-2-4-7/h1-4H2.
What are the key properties of chlorosulfonyl pyrrolidine-1-carboxylate?
chlorosulfonyl pyrrolidine-1-carboxylate has a molecular weight of 213.64 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosulfonyl pyrrolidine-1-carboxylate is sourced from PubChem (CID 156663996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).