C18H23BN2O5S2 — CID 156664015
N-[6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-2-sulfanylbenzenesulfonamide (PubChem CID 156664015) has the molecular formula C18H23BN2O5S2 and a molecular weight of 422.34 g/mol. Its IUPAC name is N-[6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-2-sulfanylbenzenesulfonamide.
| Compound Name | N-[6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-2-sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 156664015 |
| Molecular Formula | C18H23BN2O5S2 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-2-sulfanylbenzenesulfonamide |
| SMILES | COc1nc(NS(=O)(=O)c2ccccc2S)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H23BN2O5S2/c1-17(2)18(3,4)26-19(25-17)12-10-11-15(20-16(12)24-5)21-28(22,23)14-9-7-6-8-13(14)27/h6-11,27H,1-5H3,(H,20,21) |
| InChIKey | LSYHXWPQOJWMGC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|