C8H8O7 — CID 156664204
(3aR,6aR)-4-[(4S)-2-oxo-1,3-dioxolan-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-one (PubChem CID 156664204) has the molecular formula C8H8O7 and a molecular weight of 216.14 g/mol. Its IUPAC name is (3aR,6aR)-4-[(4S)-2-oxo-1,3-dioxolan-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-one.
| Compound Name | (3aR,6aR)-4-[(4S)-2-oxo-1,3-dioxolan-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-one |
|---|---|
| PubChem CID | 156664204 |
| Molecular Formula | C8H8O7 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | (3aR,6aR)-4-[(4S)-2-oxo-1,3-dioxolan-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-one |
| SMILES | O=C1OC[C@@H](C2OC[C@H]3OC(=O)O[C@@H]23)O1 |
| InChI | InChI=1S/C8H8O7/c9-7-12-2-3(13-7)5-6-4(1-11-5)14-8(10)15-6/h3-6H,1-2H2/t3-,4+,5?,6+/m0/s1 |
| InChIKey | MEZPDUFWTFNCBY-KIFFQIORSA-N |
| XLogP | -0.18 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |