About 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide
2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide (PubChem CID 156664659) has the molecular formula C10H20N2O5
and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide |
| PubChem CID | 156664659 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide |
| SMILES | CC(C(=O)NCC(=O)C(O)C(O)CO)N(C)C |
| InChI | InChI=1S/C10H20N2O5/c1-6(12(2)3)10(17)11-4-7(14)9(16)8(15)5-13/h6,8-9,13,15-16H,4-5H2,1-3H3,(H,11,17) |
| InChIKey | VEUJYJFBFOBFPC-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide?
The IUPAC name of 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide (CID 156664659) is 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide.
What is the SMILES notation for 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide?
The canonical SMILES for 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide is CC(C(=O)NCC(=O)C(O)C(O)CO)N(C)C.
What is the InChIKey of 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide?
The InChIKey is VEUJYJFBFOBFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O5/c1-6(12(2)3)10(17)11-4-7(14)9(16)8(15)5-13/h6,8-9,13,15-16H,4-5H2,1-3H3,(H,11,17).
What are the key properties of 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide?
2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide has a molecular weight of 248.28 g/mol, XLogP of -2.66, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-(3,4,5-trihydroxy-2-oxopentyl)propanamide is sourced from PubChem (CID 156664659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).