C14H26O3Si — CID 15666497
1-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-methylbut-2-en-1-one (PubChem CID 15666497) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is 1-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 15666497 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)[C@@H]1O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O3Si/c1-10(2)8-11(15)13-12(17-13)9-16-18(6,7)14(3,4)5/h8,12-13H,9H2,1-7H3/t12-,13-/m0/s1 |
| InChIKey | GMJSBEXADPDKKD-STQMWFEESA-N |
| XLogP | 3.31 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|