C21H30N2O3 — CID 156665114
tert-butyl (1R,4R,5S)-5-(5,6,7,8-tetrahydroisoquinolin-3-ylmethoxy)-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 156665114) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl (1R,4R,5S)-5-(5,6,7,8-tetrahydroisoquinolin-3-ylmethoxy)-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,4R,5S)-5-(5,6,7,8-tetrahydroisoquinolin-3-ylmethoxy)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 156665114 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | tert-butyl (1R,4R,5S)-5-(5,6,7,8-tetrahydroisoquinolin-3-ylmethoxy)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1C[C@@H]2OCc1cc2c(cn1)CCCC2 |
| InChI | InChI=1S/C21H30N2O3/c1-21(2,3)26-20(24)23-12-16-9-18(23)10-19(16)25-13-17-8-14-6-4-5-7-15(14)11-22-17/h8,11,16,18-19H,4-7,9-10,12-13H2,1-3H3/t16-,18-,19+/m1/s1 |
| InChIKey | RBNVBHXZOFGEHX-QRQLOZEOSA-N |
| XLogP | 3.87 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |