C35H38F6IrNO2S- — CID 156665172
6-(3,5-dimethylbenzene-6-id-1-yl)-3-(2,2-dimethylpropyl)-2-(trifluoromethyl)thieno[2,3-f]isoquinoline;(Z)-5-ethyl-1,1,1-trifluoro-4-hydroxy-5-methylhept-3-en-2-one;iridium (PubChem CID 156665172) has the molecular formula C35H38F6IrNO2S- and a molecular weight of 842.97 g/mol. Its IUPAC name is 6-(3,5-dimethylbenzene-6-id-1-yl)-3-(2,2-dimethylpropyl)-2-(trifluoromethyl)thieno[2,3-f]isoquinoline;(Z)-5-ethyl-1,1,1-trifluoro-4-hydroxy-5-methylhept-3-en-2-one;iridium.
| Compound Name | 6-(3,5-dimethylbenzene-6-id-1-yl)-3-(2,2-dimethylpropyl)-2-(trifluoromethyl)thieno[2,3-f]isoquinoline;(Z)-5-ethyl-1,1,1-trifluoro-4-hydroxy-5-methylhept-3-en-2-one;iridium |
|---|---|
| PubChem CID | 156665172 |
| Molecular Formula | C35H38F6IrNO2S- |
| Molecular Weight | 842.97 g/mol |
| Exact Mass | 843.22 |
| IUPAC Name | 6-(3,5-dimethylbenzene-6-id-1-yl)-3-(2,2-dimethylpropyl)-2-(trifluoromethyl)thieno[2,3-f]isoquinoline;(Z)-5-ethyl-1,1,1-trifluoro-4-hydroxy-5-methylhept-3-en-2-one;iridium |
| SMILES | CCC(C)(CC)/C(O)=C/C(=O)C(F)(F)F.Cc1[c-]c(-c2nccc3c2ccc2c(CC(C)(C)C)c(C(F)(F)F)sc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C25H23F3NS.C10H15F3O2.Ir/c1-14-10-15(2)12-16(11-14)21-17-6-7-18-20(13-24(3,4)5)23(25(26,27)28)30-22(18)19(17)8-9-29-21;1-4-9(3,5-2)7(14)6-8(15)10(11,12)13;/h6-11H,13H2,1-5H3;6,14H,4-5H2,1-3H3;/q-1;;/b;7-6-; |
| InChIKey | STBBJACOIGVOAJ-IICHUWEQSA-N |
| XLogP | 11.52 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.97 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|