C32H35F3IrNO2S- — CID 156665179
6-(3,5-dimethylbenzene-6-id-1-yl)-3-(2,2-dimethylpropyl)thieno[2,3-f]isoquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5,5-dimethylhex-3-en-2-one (PubChem CID 156665179) has the molecular formula C32H35F3IrNO2S- and a molecular weight of 746.91 g/mol. Its IUPAC name is 6-(3,5-dimethylbenzene-6-id-1-yl)-3-(2,2-dimethylpropyl)thieno[2,3-f]isoquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5,5-dimethylhex-3-en-2-one.
| Compound Name | 6-(3,5-dimethylbenzene-6-id-1-yl)-3-(2,2-dimethylpropyl)thieno[2,3-f]isoquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5,5-dimethylhex-3-en-2-one |
|---|---|
| PubChem CID | 156665179 |
| Molecular Formula | C32H35F3IrNO2S- |
| Molecular Weight | 746.91 g/mol |
| Exact Mass | 747.20 |
| IUPAC Name | 6-(3,5-dimethylbenzene-6-id-1-yl)-3-(2,2-dimethylpropyl)thieno[2,3-f]isoquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxy-5,5-dimethylhex-3-en-2-one |
| SMILES | CC(C)(C)/C(O)=C/C(=O)C(F)(F)F.Cc1[c-]c(-c2nccc3c2ccc2c(CC(C)(C)C)csc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C24H24NS.C8H11F3O2.Ir/c1-15-10-16(2)12-17(11-15)22-20-7-6-19-18(13-24(3,4)5)14-26-23(19)21(20)8-9-25-22;1-7(2,3)5(12)4-6(13)8(9,10)11;/h6-11,14H,13H2,1-5H3;4,12H,1-3H3;/q-1;;/b;5-4-; |
| InChIKey | HZDQQAZEFXIHFV-FXHNQCOHSA-N |
| XLogP | 9.73 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.91 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|