C30H31F3IrNO2S- — CID 156665213
7-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-3-methyl-2-(3,3,3-trifluoropropyl)thieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 156665213) has the molecular formula C30H31F3IrNO2S- and a molecular weight of 718.86 g/mol. Its IUPAC name is 7-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-3-methyl-2-(3,3,3-trifluoropropyl)thieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 7-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-3-methyl-2-(3,3,3-trifluoropropyl)thieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 156665213 |
| Molecular Formula | C30H31F3IrNO2S- |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 719.17 |
| IUPAC Name | 7-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-3-methyl-2-(3,3,3-trifluoropropyl)thieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1c(CCC(F)(F)F)sc2c(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nccc12.[Ir] |
| InChI | InChI=1S/C25H23F3NS.C5H8O2.Ir/c1-15-18-10-12-29-22(23(18)30-21(15)9-11-25(26,27)28)17-13-16-7-5-6-8-19(16)20(14-17)24(2,3)4;1-4(6)3-5(2)7;/h5-8,10,12,14H,9,11H2,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | FZNOPFAJUQMWOV-LWFKIUJUSA-N |
| XLogP | 9.05 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|